C21H28N4O4 — CID 160598025
cyclohexyl 1-[(2,4-dimethylbenzoyl)-(2-methyl-1,2,4-triazol-3-yl)amino]ethyl carbonate (PubChem CID 160598025) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is cyclohexyl 1-[(2,4-dimethylbenzoyl)-(2-methyl-1,2,4-triazol-3-yl)amino]ethyl carbonate.
| Compound Name | cyclohexyl 1-[(2,4-dimethylbenzoyl)-(2-methyl-1,2,4-triazol-3-yl)amino]ethyl carbonate |
|---|---|
| PubChem CID | 160598025 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | cyclohexyl 1-[(2,4-dimethylbenzoyl)-(2-methyl-1,2,4-triazol-3-yl)amino]ethyl carbonate |
| SMILES | Cc1ccc(C(=O)N(c2ncnn2C)C(C)OC(=O)OC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C21H28N4O4/c1-14-10-11-18(15(2)12-14)19(26)25(20-22-13-23-24(20)4)16(3)28-21(27)29-17-8-6-5-7-9-17/h10-13,16-17H,5-9H2,1-4H3 |
| InChIKey | DACNHBPCHJOEOH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|