C18H23ClO5 — CID 152620485
(1-chloro-2-cyclohexyloxycarbonyloxyethyl) 2,4-dimethylbenzoate (PubChem CID 152620485) has the molecular formula C18H23ClO5 and a molecular weight of 354.83 g/mol. Its IUPAC name is (1-chloro-2-cyclohexyloxycarbonyloxyethyl) 2,4-dimethylbenzoate.
| Compound Name | (1-chloro-2-cyclohexyloxycarbonyloxyethyl) 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 152620485 |
| Molecular Formula | C18H23ClO5 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (1-chloro-2-cyclohexyloxycarbonyloxyethyl) 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(Cl)COC(=O)OC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H23ClO5/c1-12-8-9-15(13(2)10-12)17(20)24-16(19)11-22-18(21)23-14-6-4-3-5-7-14/h8-10,14,16H,3-7,11H2,1-2H3 |
| InChIKey | ZBKHBSCJUHMJNS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|