C29H41ClO4 — CID 158704550
1-(chloromethyl)-4-methylbenzene;cyclohexanol;cyclohexyl (4-methylphenyl)methyl carbonate (PubChem CID 158704550) has the molecular formula C29H41ClO4 and a molecular weight of 489.10 g/mol. Its IUPAC name is 1-(chloromethyl)-4-methylbenzene;cyclohexanol;cyclohexyl (4-methylphenyl)methyl carbonate.
| Compound Name | 1-(chloromethyl)-4-methylbenzene;cyclohexanol;cyclohexyl (4-methylphenyl)methyl carbonate |
|---|---|
| PubChem CID | 158704550 |
| Molecular Formula | C29H41ClO4 |
| Molecular Weight | 489.10 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1-(chloromethyl)-4-methylbenzene;cyclohexanol;cyclohexyl (4-methylphenyl)methyl carbonate |
| SMILES | Cc1ccc(CCl)cc1.Cc1ccc(COC(=O)OC2CCCCC2)cc1.OC1CCCCC1 |
| InChI | InChI=1S/C15H20O3.C8H9Cl.C6H12O/c1-12-7-9-13(10-8-12)11-17-15(16)18-14-5-3-2-4-6-14;1-7-2-4-8(6-9)5-3-7;7-6-4-2-1-3-5-6/h7-10,14H,2-6,11H2,1H3;2-5H,6H2,1H3;6-7H,1-5H2 |
| InChIKey | IHYLDXZNDLEHAY-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.10 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|