C31H38N6O2 — CID 160606554
(7S)-15-methyl-14-[6-(4-pyrimidin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one (PubChem CID 160606554) has the molecular formula C31H38N6O2 and a molecular weight of 526.69 g/mol. Its IUPAC name is (7S)-15-methyl-14-[6-(4-pyrimidin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one.
| Compound Name | (7S)-15-methyl-14-[6-(4-pyrimidin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 160606554 |
| Molecular Formula | C31H38N6O2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (7S)-15-methyl-14-[6-(4-pyrimidin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one |
| SMILES | Cc1cc2cc3c(cc2cc1OCCCCCCN1CCN(c2ncccn2)CC1)N=C[C@@H]1CCCN1C3=O |
| InChI | InChI=1S/C31H38N6O2/c1-23-18-24-19-27-28(34-22-26-8-6-12-37(26)30(27)38)20-25(24)21-29(23)39-17-5-3-2-4-11-35-13-15-36(16-14-35)31-32-9-7-10-33-31/h7,9-10,18-22,26H,2-6,8,11-17H2,1H3/t26-/m0/s1 |
| InChIKey | HYMQHTBMFPSOIO-SANMLTNESA-N |
| XLogP | 5.02 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|