C36H41N5O5 — CID 67377824
2-[2-[4-[4-[[(6aS)-2-ethoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 67377824) has the molecular formula C36H41N5O5 and a molecular weight of 623.75 g/mol. Its IUPAC name is 2-[2-[4-[4-[[(6aS)-2-ethoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-[4-[4-[[(6aS)-2-ethoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 67377824 |
| Molecular Formula | C36H41N5O5 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 2-[2-[4-[4-[[(6aS)-2-ethoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butyl]piperazin-1-yl]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCOc1cc2c(cc1OCCCCN1CCN(CCN3C(=O)c4cccc5cccc(c45)C3=O)CC1)N=C[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C36H41N5O5/c1-2-45-31-22-29-30(37-24-26-10-7-14-40(26)36(29)44)23-32(31)46-21-4-3-13-38-15-17-39(18-16-38)19-20-41-34(42)27-11-5-8-25-9-6-12-28(33(25)27)35(41)43/h5-6,8-9,11-12,22-24,26H,2-4,7,10,13-21H2,1H3/t26-/m0/s1 |
| InChIKey | VOVOABFDTJDNRL-SANMLTNESA-N |
| XLogP | 4.63 |
| TPSA | 94.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|