C32H39N5O2 — CID 159509087
(7S)-15-methyl-14-[6-(4-pyridin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one (PubChem CID 159509087) has the molecular formula C32H39N5O2 and a molecular weight of 525.70 g/mol. Its IUPAC name is (7S)-15-methyl-14-[6-(4-pyridin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one.
| Compound Name | (7S)-15-methyl-14-[6-(4-pyridin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 159509087 |
| Molecular Formula | C32H39N5O2 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.31 |
| IUPAC Name | (7S)-15-methyl-14-[6-(4-pyridin-2-ylpiperazin-1-yl)hexoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one |
| SMILES | Cc1cc2cc3c(cc2cc1OCCCCCCN1CCN(c2ccccn2)CC1)N=C[C@@H]1CCCN1C3=O |
| InChI | InChI=1S/C32H39N5O2/c1-24-19-25-20-28-29(34-23-27-9-8-13-37(27)32(28)38)21-26(25)22-30(24)39-18-7-3-2-6-12-35-14-16-36(17-15-35)31-10-4-5-11-33-31/h4-5,10-11,19-23,27H,2-3,6-9,12-18H2,1H3/t27-/m0/s1 |
| InChIKey | QEEXBIRDZMXLHS-MHZLTWQESA-N |
| XLogP | 5.63 |
| TPSA | 61.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|