C31H36N4O2 — CID 161426948
(7S)-15-methyl-14-[3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one (PubChem CID 161426948) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is (7S)-15-methyl-14-[3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one.
| Compound Name | (7S)-15-methyl-14-[3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one |
|---|---|
| PubChem CID | 161426948 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (7S)-15-methyl-14-[3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3,9-diazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),8,11,13,15,17-hexaen-2-one |
| SMILES | Cc1ccc(N2CCN(CCCOc3cc4cc5c(cc4cc3C)C(=O)N3CCC[C@H]3C=N5)CC2)cc1 |
| InChI | InChI=1S/C31H36N4O2/c1-22-6-8-26(9-7-22)34-14-12-33(13-15-34)10-4-16-37-30-20-25-19-29-28(18-24(25)17-23(30)2)31(36)35-11-3-5-27(35)21-32-29/h6-9,17-21,27H,3-5,10-16H2,1-2H3/t27-/m0/s1 |
| InChIKey | WZFMCOKSBXVPIH-MHZLTWQESA-N |
| XLogP | 5.37 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|