C30H31IN2O4 — CID 90345599
(6aS)-3-[4-[3-iodo-4-(4-methylphenoxy)phenoxy]butoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 90345599) has the molecular formula C30H31IN2O4 and a molecular weight of 610.49 g/mol. Its IUPAC name is (6aS)-3-[4-[3-iodo-4-(4-methylphenoxy)phenoxy]butoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-[4-[3-iodo-4-(4-methylphenoxy)phenoxy]butoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 90345599 |
| Molecular Formula | C30H31IN2O4 |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | (6aS)-3-[4-[3-iodo-4-(4-methylphenoxy)phenoxy]butoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | Cc1ccc(Oc2ccc(OCCCCOc3cc4c(cc3C)C(=O)N3CCC[C@H]3C=N4)cc2I)cc1 |
| InChI | InChI=1S/C30H31IN2O4/c1-20-7-9-23(10-8-20)37-28-12-11-24(17-26(28)31)35-14-3-4-15-36-29-18-27-25(16-21(29)2)30(34)33-13-5-6-22(33)19-32-27/h7-12,16-19,22H,3-6,13-15H2,1-2H3/t22-/m0/s1 |
| InChIKey | UJVNKXHFSDOGIL-QFIPXVFZSA-N |
| XLogP | 7.26 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|