C33H37IN2O5 — CID 90345635
(6aS)-3-[5-[3-iodo-4-(3-methoxy-4,5-dimethylphenoxy)phenoxy]pentoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 90345635) has the molecular formula C33H37IN2O5 and a molecular weight of 668.57 g/mol. Its IUPAC name is (6aS)-3-[5-[3-iodo-4-(3-methoxy-4,5-dimethylphenoxy)phenoxy]pentoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-[5-[3-iodo-4-(3-methoxy-4,5-dimethylphenoxy)phenoxy]pentoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 90345635 |
| Molecular Formula | C33H37IN2O5 |
| Molecular Weight | 668.57 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | (6aS)-3-[5-[3-iodo-4-(3-methoxy-4,5-dimethylphenoxy)phenoxy]pentoxy]-2-methyl-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | COc1cc(Oc2ccc(OCCCCCOc3cc4c(cc3C)C(=O)N3CCC[C@H]3C=N4)cc2I)cc(C)c1C |
| InChI | InChI=1S/C33H37IN2O5/c1-21-15-26(18-32(38-4)23(21)3)41-30-11-10-25(17-28(30)34)39-13-6-5-7-14-40-31-19-29-27(16-22(31)2)33(37)36-12-8-9-24(36)20-35-29/h10-11,15-20,24H,5-9,12-14H2,1-4H3/t24-/m0/s1 |
| InChIKey | QLLRYUZJIYEJIM-DEOSSOPVSA-N |
| XLogP | 7.97 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.57 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|