C32H35N3O6 — CID 90345655
(6aS)-2-methyl-3-[6-[3-(4-methylphenoxy)-4-nitrophenoxy]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 90345655) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is (6aS)-2-methyl-3-[6-[3-(4-methylphenoxy)-4-nitrophenoxy]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-2-methyl-3-[6-[3-(4-methylphenoxy)-4-nitrophenoxy]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 90345655 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | (6aS)-2-methyl-3-[6-[3-(4-methylphenoxy)-4-nitrophenoxy]hexoxy]-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | Cc1ccc(Oc2cc(OCCCCCCOc3cc4c(cc3C)C(=O)N3CCC[C@H]3C=N4)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H35N3O6/c1-22-9-11-25(12-10-22)41-31-19-26(13-14-29(31)35(37)38)39-16-5-3-4-6-17-40-30-20-28-27(18-23(30)2)32(36)34-15-7-8-24(34)21-33-28/h9-14,18-21,24H,3-8,15-17H2,1-2H3/t24-/m0/s1 |
| InChIKey | FRIAPHJWTJUWKU-DEOSSOPVSA-N |
| XLogP | 7.34 |
| TPSA | 103.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|