C19H42O14P2 — CID 160614920
2,6-bis(2,2-dimethylpropyl)-2,6-dihydroxy-4,4-dimethylheptanedioic acid;phosphoric acid (PubChem CID 160614920) has the molecular formula C19H42O14P2 and a molecular weight of 556.48 g/mol. Its IUPAC name is 2,6-bis(2,2-dimethylpropyl)-2,6-dihydroxy-4,4-dimethylheptanedioic acid;phosphoric acid.
| Compound Name | 2,6-bis(2,2-dimethylpropyl)-2,6-dihydroxy-4,4-dimethylheptanedioic acid;phosphoric acid |
|---|---|
| PubChem CID | 160614920 |
| Molecular Formula | C19H42O14P2 |
| Molecular Weight | 556.48 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2,6-bis(2,2-dimethylpropyl)-2,6-dihydroxy-4,4-dimethylheptanedioic acid;phosphoric acid |
| SMILES | CC(C)(C)CC(O)(CC(C)(C)CC(O)(CC(C)(C)C)C(=O)O)C(=O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C19H36O6.2H3O4P/c1-15(2,3)9-18(24,13(20)21)11-17(7,8)12-19(25,14(22)23)10-16(4,5)6;2*1-5(2,3)4/h24-25H,9-12H2,1-8H3,(H,20,21)(H,22,23);2*(H3,1,2,3,4) |
| InChIKey | LRBPSYVEZCWMTE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 270.58 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|