C32H48ClO3PS — CID 160616390
tributyl-[[4-[4-(2,2-dimethylbutanoyloxy)phenyl]sulfanylcarbonylphenyl]methyl]phosphanium chloride (PubChem CID 160616390) has the molecular formula C32H48ClO3PS and a molecular weight of 579.23 g/mol. Its IUPAC name is tributyl-[[4-[4-(2,2-dimethylbutanoyloxy)phenyl]sulfanylcarbonylphenyl]methyl]phosphanium chloride.
| Compound Name | tributyl-[[4-[4-(2,2-dimethylbutanoyloxy)phenyl]sulfanylcarbonylphenyl]methyl]phosphanium chloride |
|---|---|
| PubChem CID | 160616390 |
| Molecular Formula | C32H48ClO3PS |
| Molecular Weight | 579.23 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | tributyl-[[4-[4-(2,2-dimethylbutanoyloxy)phenyl]sulfanylcarbonylphenyl]methyl]phosphanium chloride |
| SMILES | CCCC[P+](CCCC)(CCCC)Cc1ccc(C(=O)Sc2ccc(OC(=O)C(C)(C)CC)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C32H48O3PS.ClH/c1-7-11-22-36(23-12-8-2,24-13-9-3)25-26-14-16-27(17-15-26)30(33)37-29-20-18-28(19-21-29)35-31(34)32(5,6)10-4;/h14-21H,7-13,22-25H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | YRQVLZCKVYMHQQ-UHFFFAOYSA-M |
| XLogP | 6.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.23 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|