C36H59O22P2S+ — CID 160620075
bis[1-(2-hydroxyethoxy)-1-oxopropan-2-yl] propanedioate;bis[1-[2-(oxan-2-yloxy)ethoxy]-1-oxopropan-2-yl] propanedioate;phosphanyl-sulfanylidene-tritiophosphanium (PubChem CID 160620075) has the molecular formula C36H59O22P2S+ and a molecular weight of 939.87 g/mol. Its IUPAC name is bis[1-(2-hydroxyethoxy)-1-oxopropan-2-yl] propanedioate;bis[1-[2-(oxan-2-yloxy)ethoxy]-1-oxopropan-2-yl] propanedioate;phosphanyl-sulfanylidene-tritiophosphanium.
| Compound Name | bis[1-(2-hydroxyethoxy)-1-oxopropan-2-yl] propanedioate;bis[1-[2-(oxan-2-yloxy)ethoxy]-1-oxopropan-2-yl] propanedioate;phosphanyl-sulfanylidene-tritiophosphanium |
|---|---|
| PubChem CID | 160620075 |
| Molecular Formula | C36H59O22P2S+ |
| Molecular Weight | 939.87 g/mol |
| Exact Mass | 939.28 |
| IUPAC Name | bis[1-(2-hydroxyethoxy)-1-oxopropan-2-yl] propanedioate;bis[1-[2-(oxan-2-yloxy)ethoxy]-1-oxopropan-2-yl] propanedioate;phosphanyl-sulfanylidene-tritiophosphanium |
| SMILES | CC(OC(=O)CC(=O)OC(C)C(=O)OCCO)C(=O)OCCO.CC(OC(=O)CC(=O)OC(C)C(=O)OCCOC1CCCCO1)C(=O)OCCOC1CCCCO1.[3H][P+](P)=S |
| InChI | InChI=1S/C23H36O12.C13H20O10.H2P2S/c1-16(22(26)32-13-11-30-20-7-3-5-9-28-20)34-18(24)15-19(25)35-17(2)23(27)33-14-12-31-21-8-4-6-10-29-21;1-8(12(18)20-5-3-14)22-10(16)7-11(17)23-9(2)13(19)21-6-4-15;1-2-3/h16-17,20-21H,3-15H2,1-2H3;8-9,14-15H,3-7H2,1-2H3;1H2/p+1/i/hT |
| InChIKey | UCEFMBMHPLUSGU-MNYXATJNSA-O |
| XLogP | 0.64 |
| TPSA | 287.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.87 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|