About 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate
3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate (PubChem CID 118181943) has the molecular formula C24H47NO6
and a molecular weight of 445.64 g/mol. Its IUPAC name is 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate |
| PubChem CID | 118181943 |
| Molecular Formula | C24H47NO6 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.34 |
| IUPAC Name | 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate |
| SMILES | CN(C)CCCOC(=O)OC(CCO)CCCCCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C24H47NO6/c1-25(2)17-13-21-30-24(27)31-22(16-18-26)14-9-7-5-3-4-6-8-11-19-28-23-15-10-12-20-29-23/h22-23,26H,3-21H2,1-2H3 |
| InChIKey | YVSYTZGSPNMUSV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate?
The IUPAC name of 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate (CID 118181943) is 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate.
What is the SMILES notation for 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate?
The canonical SMILES for 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate is CN(C)CCCOC(=O)OC(CCO)CCCCCCCCCCOC1CCCCO1.
What is the InChIKey of 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate?
The InChIKey is YVSYTZGSPNMUSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H47NO6/c1-25(2)17-13-21-30-24(27)31-22(16-18-26)14-9-7-5-3-4-6-8-11-19-28-23-15-10-12-20-29-23/h22-23,26H,3-21H2,1-2H3.
What are the key properties of 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate?
3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate has a molecular weight of 445.64 g/mol, XLogP of 4.90, 19 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl [1-hydroxy-13-(oxan-2-yloxy)tridecan-3-yl] carbonate is sourced from PubChem (CID 118181943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).