C49H91NO6 — CID 140736951
3-(dimethylamino)propyl [(Z,14R)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-14-(oxan-2-yloxy)icos-11-en-2-yl] carbonate (PubChem CID 140736951) has the molecular formula C49H91NO6 and a molecular weight of 790.27 g/mol. Its IUPAC name is 3-(dimethylamino)propyl [(Z,14R)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-14-(oxan-2-yloxy)icos-11-en-2-yl] carbonate.
| Compound Name | 3-(dimethylamino)propyl [(Z,14R)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-14-(oxan-2-yloxy)icos-11-en-2-yl] carbonate |
|---|---|
| PubChem CID | 140736951 |
| Molecular Formula | C49H91NO6 |
| Molecular Weight | 790.27 g/mol |
| Exact Mass | 789.68 |
| IUPAC Name | 3-(dimethylamino)propyl [(Z,14R)-1-[(9Z,12Z)-octadeca-9,12-dienoxy]-14-(oxan-2-yloxy)icos-11-en-2-yl] carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CCCCCCCC/C=C\C[C@@H](CCCCCC)OC1CCCCO1)OC(=O)OCCCN(C)C |
| InChI | InChI=1S/C49H91NO6/c1-5-7-9-11-12-13-14-15-16-17-18-19-23-26-29-34-42-52-45-47(56-49(51)54-44-36-41-50(3)4)39-32-28-25-22-20-21-24-27-31-38-46(37-30-10-8-6-2)55-48-40-33-35-43-53-48/h12-13,15-16,27,31,46-48H,5-11,14,17-26,28-30,32-45H2,1-4H3/b13-12-,16-15-,31-27-/t46-,47?,48?/m1/s1 |
| InChIKey | RZWAQCXNFFALJD-MWWMYAGUSA-N |
| XLogP | 14.24 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.27 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|