C13H25Cl3 — CID 160631730
3,3,5-trichloro-4-ethylundecane (PubChem CID 160631730) has the molecular formula C13H25Cl3 and a molecular weight of 287.70 g/mol. Its IUPAC name is 3,3,5-trichloro-4-ethylundecane.
| Compound Name | 3,3,5-trichloro-4-ethylundecane |
|---|---|
| PubChem CID | 160631730 |
| Molecular Formula | C13H25Cl3 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3,3,5-trichloro-4-ethylundecane |
| SMILES | CCCCCCC(Cl)C(CC)C(Cl)(Cl)CC |
| InChI | InChI=1S/C13H25Cl3/c1-4-7-8-9-10-12(14)11(5-2)13(15,16)6-3/h11-12H,4-10H2,1-3H3 |
| InChIKey | FZNVVWQKGKIDPD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|