C35H32N4O6 — CID 160632715
4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]benzaldehyde;(E)-4-[4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]phenyl]but-3-en-2-one (PubChem CID 160632715) has the molecular formula C35H32N4O6 and a molecular weight of 604.66 g/mol. Its IUPAC name is 4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]benzaldehyde;(E)-4-[4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]phenyl]but-3-en-2-one.
| Compound Name | 4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]benzaldehyde;(E)-4-[4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 160632715 |
| Molecular Formula | C35H32N4O6 |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]benzaldehyde;(E)-4-[4-[(5-nitro-2,3-dihydroindol-1-yl)methyl]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc(CN2CCc3cc([N+](=O)[O-])ccc32)cc1.O=Cc1ccc(CN2CCc3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C19H18N2O3.C16H14N2O3/c1-14(22)2-3-15-4-6-16(7-5-15)13-20-11-10-17-12-18(21(23)24)8-9-19(17)20;19-11-13-3-1-12(2-4-13)10-17-8-7-14-9-15(18(20)21)5-6-16(14)17/h2-9,12H,10-11,13H2,1H3;1-6,9,11H,7-8,10H2/b3-2+; |
| InChIKey | RICVKIQGEIWZMX-SQQVDAMQSA-N |
| XLogP | 6.73 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|