C15H17ClF3S+ — CID 160632923
2-cyclopentyl-4-methyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrochloride (PubChem CID 160632923) has the molecular formula C15H17ClF3S+ and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-cyclopentyl-4-methyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrochloride.
| Compound Name | 2-cyclopentyl-4-methyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrochloride |
|---|---|
| PubChem CID | 160632923 |
| Molecular Formula | C15H17ClF3S+ |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-cyclopentyl-4-methyl-1-(trifluoromethyl)-1-benzothiophen-1-ium;hydrochloride |
| SMILES | Cc1cccc2c1cc(C1CCCC1)[s+]2C(F)(F)F.Cl |
| InChI | InChI=1S/C15H16F3S.ClH/c1-10-5-4-8-13-12(10)9-14(11-6-2-3-7-11)19(13)15(16,17)18;/h4-5,8-9,11H,2-3,6-7H2,1H3;1H/q+1; |
| InChIKey | CDAWBYTWCXHVOC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|