About 2-aminocyclopentene-1-carbonitrile;methanimidamide
2-aminocyclopentene-1-carbonitrile;methanimidamide (PubChem CID 160641869) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-aminocyclopentene-1-carbonitrile;methanimidamide.
Molecular Properties
| Compound Name | 2-aminocyclopentene-1-carbonitrile;methanimidamide |
| PubChem CID | 160641869 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 2-aminocyclopentene-1-carbonitrile;methanimidamide |
| SMILES | N#CC1=C(N)CCC1.[H]/N=C/N |
| InChI | InChI=1S/C6H8N2.CH4N2/c7-4-5-2-1-3-6(5)8;2-1-3/h1-3,8H2;1H,(H3,2,3) |
| InChIKey | RJGYSNVSBKREFH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminocyclopentene-1-carbonitrile;methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminocyclopentene-1-carbonitrile;methanimidamide?
The IUPAC name of 2-aminocyclopentene-1-carbonitrile;methanimidamide (CID 160641869) is 2-aminocyclopentene-1-carbonitrile;methanimidamide.
What is the SMILES notation for 2-aminocyclopentene-1-carbonitrile;methanimidamide?
The canonical SMILES for 2-aminocyclopentene-1-carbonitrile;methanimidamide is N#CC1=C(N)CCC1.[H]/N=C/N.
What is the InChIKey of 2-aminocyclopentene-1-carbonitrile;methanimidamide?
The InChIKey is RJGYSNVSBKREFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.CH4N2/c7-4-5-2-1-3-6(5)8;2-1-3/h1-3,8H2;1H,(H3,2,3).
What are the key properties of 2-aminocyclopentene-1-carbonitrile;methanimidamide?
2-aminocyclopentene-1-carbonitrile;methanimidamide has a molecular weight of 152.20 g/mol, XLogP of 0.46, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminocyclopentene-1-carbonitrile;methanimidamide is sourced from PubChem (CID 160641869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).