C16H20N6O5 — CID 160641881
ethyl 2-[[(1-methyltriazol-4-yl)methyl-[(4-nitrophenyl)methyl]carbamoyl]amino]acetate (PubChem CID 160641881) has the molecular formula C16H20N6O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is ethyl 2-[[(1-methyltriazol-4-yl)methyl-[(4-nitrophenyl)methyl]carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[(1-methyltriazol-4-yl)methyl-[(4-nitrophenyl)methyl]carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 160641881 |
| Molecular Formula | C16H20N6O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | ethyl 2-[[(1-methyltriazol-4-yl)methyl-[(4-nitrophenyl)methyl]carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(Cc1ccc([N+](=O)[O-])cc1)Cc1cn(C)nn1 |
| InChI | InChI=1S/C16H20N6O5/c1-3-27-15(23)8-17-16(24)21(11-13-10-20(2)19-18-13)9-12-4-6-14(7-5-12)22(25)26/h4-7,10H,3,8-9,11H2,1-2H3,(H,17,24) |
| InChIKey | RJGZVAOUNNHVIU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|