C33H44N14O8 — CID 167708304
(4-nitrophenyl) 5-[[1,7-bis[(1-methyltriazol-4-yl)methylamino]-4-[3-[(1-methyltriazol-4-yl)methylamino]-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-5-oxopentanoate (PubChem CID 167708304) has the molecular formula C33H44N14O8 and a molecular weight of 764.81 g/mol. Its IUPAC name is (4-nitrophenyl) 5-[[1,7-bis[(1-methyltriazol-4-yl)methylamino]-4-[3-[(1-methyltriazol-4-yl)methylamino]-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-5-oxopentanoate.
| Compound Name | (4-nitrophenyl) 5-[[1,7-bis[(1-methyltriazol-4-yl)methylamino]-4-[3-[(1-methyltriazol-4-yl)methylamino]-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 167708304 |
| Molecular Formula | C33H44N14O8 |
| Molecular Weight | 764.81 g/mol |
| Exact Mass | 764.35 |
| IUPAC Name | (4-nitrophenyl) 5-[[1,7-bis[(1-methyltriazol-4-yl)methylamino]-4-[3-[(1-methyltriazol-4-yl)methylamino]-3-oxopropyl]-1,7-dioxoheptan-4-yl]amino]-5-oxopentanoate |
| SMILES | Cn1cc(CNC(=O)CCC(CCC(=O)NCc2cn(C)nn2)(CCC(=O)NCc2cn(C)nn2)NC(=O)CCCC(=O)Oc2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C33H44N14O8/c1-44-20-23(38-41-44)17-34-28(48)11-14-33(15-12-29(49)35-18-24-21-45(2)42-39-24,16-13-30(50)36-19-25-22-46(3)43-40-25)37-31(51)5-4-6-32(52)55-27-9-7-26(8-10-27)47(53)54/h7-10,20-22H,4-6,11-19H2,1-3H3,(H,34,48)(H,35,49)(H,36,50)(H,37,51) |
| InChIKey | ZLDRPKJLUHABSA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 277.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.81 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|