C42H44FN5O4 — CID 160641994
(4-cyano-3-fluorophenyl) 4-(6-hexylpyridazin-3-yl)benzoate;4-(6-heptylpyridazin-3-yl)benzoic acid (PubChem CID 160641994) has the molecular formula C42H44FN5O4 and a molecular weight of 701.84 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-(6-hexylpyridazin-3-yl)benzoate;4-(6-heptylpyridazin-3-yl)benzoic acid.
| Compound Name | (4-cyano-3-fluorophenyl) 4-(6-hexylpyridazin-3-yl)benzoate;4-(6-heptylpyridazin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 160641994 |
| Molecular Formula | C42H44FN5O4 |
| Molecular Weight | 701.84 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-(6-hexylpyridazin-3-yl)benzoate;4-(6-heptylpyridazin-3-yl)benzoic acid |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)O)cc2)nn1.CCCCCCc1ccc(-c2ccc(C(=O)Oc3ccc(C#N)c(F)c3)cc2)nn1 |
| InChI | InChI=1S/C24H22FN3O2.C18H22N2O2/c1-2-3-4-5-6-20-12-14-23(28-27-20)17-7-9-18(10-8-17)24(29)30-21-13-11-19(16-26)22(25)15-21;1-2-3-4-5-6-7-16-12-13-17(20-19-16)14-8-10-15(11-9-14)18(21)22/h7-15H,2-6H2,1H3;8-13H,2-7H2,1H3,(H,21,22) |
| InChIKey | RJHLDMPHVNSSRY-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.84 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|