C10H21ClN2O3 — CID 160649410
4-aminocyclohexane-1-carboxylic acid;N,N-dimethylformamide;hydrochloride (PubChem CID 160649410) has the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. Its IUPAC name is 4-aminocyclohexane-1-carboxylic acid;N,N-dimethylformamide;hydrochloride.
| Compound Name | 4-aminocyclohexane-1-carboxylic acid;N,N-dimethylformamide;hydrochloride |
|---|---|
| PubChem CID | 160649410 |
| Molecular Formula | C10H21ClN2O3 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4-aminocyclohexane-1-carboxylic acid;N,N-dimethylformamide;hydrochloride |
| SMILES | CN(C)C=O.Cl.NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C7H13NO2.C3H7NO.ClH/c8-6-3-1-5(2-4-6)7(9)10;1-4(2)3-5;/h5-6H,1-4,8H2,(H,9,10);3H,1-2H3;1H |
| InChIKey | ODKRELZABXGRPV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|