C26H49BO2 — CID 160649441
dibutylboranyl (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 160649441) has the molecular formula C26H49BO2 and a molecular weight of 404.49 g/mol. Its IUPAC name is dibutylboranyl (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | dibutylboranyl (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 160649441 |
| Molecular Formula | C26H49BO2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.38 |
| IUPAC Name | dibutylboranyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OB(CCCC)CCCC |
| InChI | InChI=1S/C26H49BO2/c1-4-7-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26(28)29-27(24-8-5-2)25-9-6-3/h12-13,15-16H,4-11,14,17-25H2,1-3H3/b13-12-,16-15- |
| InChIKey | GWNICKGYHBDLBU-QGLGPCELSA-N |
| XLogP | 8.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|