About methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate
methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate (PubChem CID 160652663) has the molecular formula C21H23BrO8S2
and a molecular weight of 547.45 g/mol. Its IUPAC name is methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate.
Molecular Properties
| Compound Name | methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate |
| PubChem CID | 160652663 |
| Molecular Formula | C21H23BrO8S2 |
| Molecular Weight | 547.45 g/mol |
| Exact Mass | 546.00 |
| IUPAC Name | methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate |
| SMILES | C=C(C)c1ccc(C(=O)OC)cc1S(C)(=O)=O.COC(=O)c1ccc(Br)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H14O4S.C9H9BrO4S/c1-8(2)10-6-5-9(12(13)16-3)7-11(10)17(4,14)15;1-14-9(11)6-3-4-7(10)8(5-6)15(2,12)13/h5-7H,1H2,2-4H3;3-5H,1-2H3 |
| InChIKey | RKQAORSDAGGVGJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate?
The IUPAC name of methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate (CID 160652663) is methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate.
What is the SMILES notation for methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate?
The canonical SMILES for methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate is C=C(C)c1ccc(C(=O)OC)cc1S(C)(=O)=O.COC(=O)c1ccc(Br)c(S(C)(=O)=O)c1.
What is the InChIKey of methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate?
The InChIKey is RKQAORSDAGGVGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4S.C9H9BrO4S/c1-8(2)10-6-5-9(12(13)16-3)7-11(10)17(4,14)15;1-14-9(11)6-3-4-7(10)8(5-6)15(2,12)13/h5-7H,1H2,2-4H3;3-5H,1-2H3.
What are the key properties of methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate?
methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate has a molecular weight of 547.45 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-3-methylsulfonylbenzoate;methyl 3-methylsulfonyl-4-prop-1-en-2-ylbenzoate is sourced from PubChem (CID 160652663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).