C27H22N2O6 — CID 160663275
2-amino-6-methoxybenzoic acid;5-methoxy-2-naphthalen-1-yl-3,1-benzoxazin-4-one (PubChem CID 160663275) has the molecular formula C27H22N2O6 and a molecular weight of 470.48 g/mol. Its IUPAC name is 2-amino-6-methoxybenzoic acid;5-methoxy-2-naphthalen-1-yl-3,1-benzoxazin-4-one.
| Compound Name | 2-amino-6-methoxybenzoic acid;5-methoxy-2-naphthalen-1-yl-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 160663275 |
| Molecular Formula | C27H22N2O6 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-amino-6-methoxybenzoic acid;5-methoxy-2-naphthalen-1-yl-3,1-benzoxazin-4-one |
| SMILES | COc1cccc(N)c1C(=O)O.COc1cccc2nc(-c3cccc4ccccc34)oc(=O)c12 |
| InChI | InChI=1S/C19H13NO3.C8H9NO3/c1-22-16-11-5-10-15-17(16)19(21)23-18(20-15)14-9-4-7-12-6-2-3-8-13(12)14;1-12-6-4-2-3-5(9)7(6)8(10)11/h2-11H,1H3;2-4H,9H2,1H3,(H,10,11) |
| InChIKey | RLYLCVGJTQHINZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|