C33H26F6N2O5S2 — CID 160663355
4,8-bis[[4-(trifluoromethyl)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;dodeca-2,4,6,8,10-pentayne (PubChem CID 160663355) has the molecular formula C33H26F6N2O5S2 and a molecular weight of 708.70 g/mol. Its IUPAC name is 4,8-bis[[4-(trifluoromethyl)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;dodeca-2,4,6,8,10-pentayne.
| Compound Name | 4,8-bis[[4-(trifluoromethyl)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;dodeca-2,4,6,8,10-pentayne |
|---|---|
| PubChem CID | 160663355 |
| Molecular Formula | C33H26F6N2O5S2 |
| Molecular Weight | 708.70 g/mol |
| Exact Mass | 708.12 |
| IUPAC Name | 4,8-bis[[4-(trifluoromethyl)phenyl]sulfonyl]-1-oxa-4,8-diazaspiro[4.5]decane;dodeca-2,4,6,8,10-pentayne |
| SMILES | CC#CC#CC#CC#CC#CC.O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCC2(CC1)OCCN2S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F6N2O5S2.C12H6/c22-20(23,24)15-1-5-17(6-2-15)35(30,31)28-11-9-19(10-12-28)29(13-14-34-19)36(32,33)18-7-3-16(4-8-18)21(25,26)27;1-3-5-7-9-11-12-10-8-6-4-2/h1-8H,9-14H2;1-2H3 |
| InChIKey | RLYRAQLZDJTSPP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.70 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|