C45H40N2O2 — CID 160663476
(2Z,4E)-3-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-isocyano-5-(4-pentylphenyl)penta-2,4-dienenitrile (PubChem CID 160663476) has the molecular formula C45H40N2O2 and a molecular weight of 640.83 g/mol. Its IUPAC name is (2Z,4E)-3-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-isocyano-5-(4-pentylphenyl)penta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-3-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-isocyano-5-(4-pentylphenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 160663476 |
| Molecular Formula | C45H40N2O2 |
| Molecular Weight | 640.83 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | (2Z,4E)-3-[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-2-isocyano-5-(4-pentylphenyl)penta-2,4-dienenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(/C=C/c1ccc(CCCCC)cc1)c1ccc(C(=C(c2ccc(OC)cc2)c2ccc(OC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H40N2O2/c1-5-6-8-11-33-14-16-34(17-15-33)18-31-42(43(32-46)47-2)35-19-21-37(22-20-35)44(36-12-9-7-10-13-36)45(38-23-27-40(48-3)28-24-38)39-25-29-41(49-4)30-26-39/h7,9-10,12-31H,5-6,8,11H2,1,3-4H3/b31-18+,43-42- |
| InChIKey | XKFUCPQZWXOUKI-VSBFOGQWSA-N |
| XLogP | 11.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.83 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|