C25H30O7 — CID 160671836
molecular hydrogen;(3S,4R,6S)-4,5,6-trihydroxy-2-methyl-3-[4-[(1Z)-3-(4-methylphenyl)penta-1,4-dienyl]phenoxy]oxane-2-carboxylic acid (PubChem CID 160671836) has the molecular formula C25H30O7 and a molecular weight of 442.51 g/mol. Its IUPAC name is molecular hydrogen;(3S,4R,6S)-4,5,6-trihydroxy-2-methyl-3-[4-[(1Z)-3-(4-methylphenyl)penta-1,4-dienyl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | molecular hydrogen;(3S,4R,6S)-4,5,6-trihydroxy-2-methyl-3-[4-[(1Z)-3-(4-methylphenyl)penta-1,4-dienyl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 160671836 |
| Molecular Formula | C25H30O7 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | molecular hydrogen;(3S,4R,6S)-4,5,6-trihydroxy-2-methyl-3-[4-[(1Z)-3-(4-methylphenyl)penta-1,4-dienyl]phenoxy]oxane-2-carboxylic acid |
| SMILES | C=CC(/C=C\c1ccc(O[C@H]2[C@H](O)C(O)[C@@H](O)OC2(C)C(=O)O)cc1)c1ccc(C)cc1.[H][H] |
| InChI | InChI=1S/C25H28O7.H2/c1-4-17(18-10-5-15(2)6-11-18)12-7-16-8-13-19(14-9-16)31-22-20(26)21(27)23(28)32-25(22,3)24(29)30;/h4-14,17,20-23,26-28H,1H2,2-3H3,(H,29,30);1H/b12-7-;/t17?,20-,21?,22+,23+,25?;/m1./s1 |
| InChIKey | RNAIDNIGMRLSRN-DJQQBYDZSA-N |
| XLogP | 2.89 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|