C48H41BrO9 — CID 160673113
8-bromo-3-(4-hydroxyphenyl)-2H-chromen-7-ol;4-ethyl-3-(4-hydroxyphenyl)-2H-chromen-7-ol;3-(4-hydroxyphenyl)-4-methyl-2H-chromen-7-ol (PubChem CID 160673113) has the molecular formula C48H41BrO9 and a molecular weight of 841.75 g/mol. Its IUPAC name is 8-bromo-3-(4-hydroxyphenyl)-2H-chromen-7-ol;4-ethyl-3-(4-hydroxyphenyl)-2H-chromen-7-ol;3-(4-hydroxyphenyl)-4-methyl-2H-chromen-7-ol.
| Compound Name | 8-bromo-3-(4-hydroxyphenyl)-2H-chromen-7-ol;4-ethyl-3-(4-hydroxyphenyl)-2H-chromen-7-ol;3-(4-hydroxyphenyl)-4-methyl-2H-chromen-7-ol |
|---|---|
| PubChem CID | 160673113 |
| Molecular Formula | C48H41BrO9 |
| Molecular Weight | 841.75 g/mol |
| Exact Mass | 840.19 |
| IUPAC Name | 8-bromo-3-(4-hydroxyphenyl)-2H-chromen-7-ol;4-ethyl-3-(4-hydroxyphenyl)-2H-chromen-7-ol;3-(4-hydroxyphenyl)-4-methyl-2H-chromen-7-ol |
| SMILES | CC1=C(c2ccc(O)cc2)COc2cc(O)ccc21.CCC1=C(c2ccc(O)cc2)COc2cc(O)ccc21.Oc1ccc(C2=Cc3ccc(O)c(Br)c3OC2)cc1 |
| InChI | InChI=1S/C17H16O3.C16H14O3.C15H11BrO3/c1-2-14-15-8-7-13(19)9-17(15)20-10-16(14)11-3-5-12(18)6-4-11;1-10-14-7-6-13(18)8-16(14)19-9-15(10)11-2-4-12(17)5-3-11;16-14-13(18)6-3-10-7-11(8-19-15(10)14)9-1-4-12(17)5-2-9/h3-9,18-19H,2,10H2,1H3;2-8,17-18H,9H2,1H3;1-7,17-18H,8H2 |
| InChIKey | RNEPLWWDYYARCQ-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.75 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|