C16H12F2O2 — CID 145102601
3-(3,5-difluorophenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 145102601) has the molecular formula C16H12F2O2 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | 3-(3,5-difluorophenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 145102601 |
| Molecular Formula | C16H12F2O2 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-(3,5-difluorophenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2cc(F)cc(F)c2)COc2ccc(O)cc21 |
| InChI | InChI=1S/C16H12F2O2/c1-9-14-7-13(19)2-3-16(14)20-8-15(9)10-4-11(17)6-12(18)5-10/h2-7,19H,8H2,1H3 |
| InChIKey | OMSHGZZAVMEYQB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|