C29H28F2N2O3 — CID 144763231
3-fluoro-4-(6-hydroxy-4-methyl-2H-chromen-3-yl)benzonitrile;3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine (PubChem CID 144763231) has the molecular formula C29H28F2N2O3 and a molecular weight of 490.55 g/mol. Its IUPAC name is 3-fluoro-4-(6-hydroxy-4-methyl-2H-chromen-3-yl)benzonitrile;3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine.
| Compound Name | 3-fluoro-4-(6-hydroxy-4-methyl-2H-chromen-3-yl)benzonitrile;3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine |
|---|---|
| PubChem CID | 144763231 |
| Molecular Formula | C29H28F2N2O3 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-fluoro-4-(6-hydroxy-4-methyl-2H-chromen-3-yl)benzonitrile;3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine |
| SMILES | CC1=C(c2ccc(C#N)cc2F)COc2ccc(O)cc21.FCC1CN(CCOc2ccccc2)C1 |
| InChI | InChI=1S/C17H12FNO2.C12H16FNO/c1-10-14-7-12(20)3-5-17(14)21-9-15(10)13-4-2-11(8-19)6-16(13)18;13-8-11-9-14(10-11)6-7-15-12-4-2-1-3-5-12/h2-7,20H,9H2,1H3;1-5,11H,6-10H2 |
| InChIKey | DTVVLWULZVQJEH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|