C29H31F2NO3 — CID 145102646
3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine;3-(5-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol (PubChem CID 145102646) has the molecular formula C29H31F2NO3 and a molecular weight of 479.57 g/mol. Its IUPAC name is 3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine;3-(5-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol.
| Compound Name | 3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine;3-(5-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 145102646 |
| Molecular Formula | C29H31F2NO3 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 3-(fluoromethyl)-1-(2-phenoxyethyl)azetidine;3-(5-fluoro-2-methylphenyl)-4-methyl-2H-chromen-6-ol |
| SMILES | CC1=C(c2cc(F)ccc2C)COc2ccc(O)cc21.FCC1CN(CCOc2ccccc2)C1 |
| InChI | InChI=1S/C17H15FO2.C12H16FNO/c1-10-3-4-12(18)7-14(10)16-9-20-17-6-5-13(19)8-15(17)11(16)2;13-8-11-9-14(10-11)6-7-15-12-4-2-1-3-5-12/h3-8,19H,9H2,1-2H3;1-5,11H,6-10H2 |
| InChIKey | YNQOEFRGDQRTDW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|