C31H48N4O14 — CID 160685908
(2,5-dioxopyrrolidin-1-yl) 3-[4-[5-[2-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropanoyl]amino]ethoxy]-2,2-bis(2-methoxyethyl)pentoxy]butylamino]-3-oxopropanoate (PubChem CID 160685908) has the molecular formula C31H48N4O14 and a molecular weight of 700.74 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[4-[5-[2-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropanoyl]amino]ethoxy]-2,2-bis(2-methoxyethyl)pentoxy]butylamino]-3-oxopropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[5-[2-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropanoyl]amino]ethoxy]-2,2-bis(2-methoxyethyl)pentoxy]butylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 160685908 |
| Molecular Formula | C31H48N4O14 |
| Molecular Weight | 700.74 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[5-[2-[[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropanoyl]amino]ethoxy]-2,2-bis(2-methoxyethyl)pentoxy]butylamino]-3-oxopropanoate |
| SMILES | COCCC(CCCOCCNC(=O)CC(=O)ON1C(=O)CCC1=O)(CCOC)COCCCCNC(=O)CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C31H48N4O14/c1-44-17-11-31(12-18-45-2,10-5-16-46-19-14-33-24(37)21-30(43)49-35-27(40)8-9-28(35)41)22-47-15-4-3-13-32-23(36)20-29(42)48-34-25(38)6-7-26(34)39/h3-22H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | ZCXAQJBYFJKJFI-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 222.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.74 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|