C34H59N5O5S2 — CID 160690199
N-[2-[[6-[3-[2-(dimethylamino)ethyl-(4-oxohex-5-enyl)amino]propyl-[(prop-2-enoylamino)methyl]amino]-4-oxohexyl]disulfanyl]ethyl]-7-oxonon-8-enamide (PubChem CID 160690199) has the molecular formula C34H59N5O5S2 and a molecular weight of 682.01 g/mol. Its IUPAC name is N-[2-[[6-[3-[2-(dimethylamino)ethyl-(4-oxohex-5-enyl)amino]propyl-[(prop-2-enoylamino)methyl]amino]-4-oxohexyl]disulfanyl]ethyl]-7-oxonon-8-enamide.
| Compound Name | N-[2-[[6-[3-[2-(dimethylamino)ethyl-(4-oxohex-5-enyl)amino]propyl-[(prop-2-enoylamino)methyl]amino]-4-oxohexyl]disulfanyl]ethyl]-7-oxonon-8-enamide |
|---|---|
| PubChem CID | 160690199 |
| Molecular Formula | C34H59N5O5S2 |
| Molecular Weight | 682.01 g/mol |
| Exact Mass | 681.40 |
| IUPAC Name | N-[2-[[6-[3-[2-(dimethylamino)ethyl-(4-oxohex-5-enyl)amino]propyl-[(prop-2-enoylamino)methyl]amino]-4-oxohexyl]disulfanyl]ethyl]-7-oxonon-8-enamide |
| SMILES | C=CC(=O)CCCCCC(=O)NCCSSCCCC(=O)CCN(CCCN(CCCC(=O)C=C)CCN(C)C)CNC(=O)C=C |
| InChI | InChI=1S/C34H59N5O5S2/c1-6-30(40)15-10-9-11-18-34(44)35-20-28-46-45-27-13-17-32(42)19-24-39(29-36-33(43)8-3)23-14-22-38(26-25-37(4)5)21-12-16-31(41)7-2/h6-8H,1-3,9-29H2,4-5H3,(H,35,44)(H,36,43) |
| InChIKey | ABNMIPNYHNHWQP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.01 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|