C37H26N2OS3 — CID 160695674
chromeno[2,3-c]pyridine-5-thione;diphenylmethanethione;phenyl(pyridin-4-yl)methanethione (PubChem CID 160695674) has the molecular formula C37H26N2OS3 and a molecular weight of 610.83 g/mol. Its IUPAC name is chromeno[2,3-c]pyridine-5-thione;diphenylmethanethione;phenyl(pyridin-4-yl)methanethione.
| Compound Name | chromeno[2,3-c]pyridine-5-thione;diphenylmethanethione;phenyl(pyridin-4-yl)methanethione |
|---|---|
| PubChem CID | 160695674 |
| Molecular Formula | C37H26N2OS3 |
| Molecular Weight | 610.83 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | chromeno[2,3-c]pyridine-5-thione;diphenylmethanethione;phenyl(pyridin-4-yl)methanethione |
| SMILES | S=C(c1ccccc1)c1ccccc1.S=C(c1ccccc1)c1ccncc1.S=c1c2ccccc2oc2cnccc12 |
| InChI | InChI=1S/C13H10S.C12H7NOS.C12H9NS/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;15-12-8-3-1-2-4-10(8)14-11-7-13-6-5-9(11)12;14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-10H;1-7H;1-9H |
| InChIKey | RPYSFFNDQKCJEL-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.83 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|