C12H8N2O2 — CID 137205389
N-chromeno[2,3-c]pyridin-5-ylidenehydroxylamine (PubChem CID 137205389) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is N-chromeno[2,3-c]pyridin-5-ylidenehydroxylamine.
| Compound Name | N-chromeno[2,3-c]pyridin-5-ylidenehydroxylamine |
|---|---|
| PubChem CID | 137205389 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | N-chromeno[2,3-c]pyridin-5-ylidenehydroxylamine |
| SMILES | ON=c1c2ccccc2oc2cnccc12 |
| InChI | InChI=1S/C12H8N2O2/c15-14-12-8-3-1-2-4-10(8)16-11-7-13-6-5-9(11)12/h1-7,15H |
| InChIKey | LVZRNBDXJPEWDK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|