C34H54Cl2N6 — CID 160698764
4-[3-[1-[6-[1-[1-(4-aminophenyl)pyrrolidin-3-yl]pyrrolidin-1-ium-1-yl]hexyl]pyrrolidin-1-ium-1-yl]pyrrolidin-1-yl]aniline dichloride (PubChem CID 160698764) has the molecular formula C34H54Cl2N6 and a molecular weight of 617.75 g/mol. Its IUPAC name is 4-[3-[1-[6-[1-[1-(4-aminophenyl)pyrrolidin-3-yl]pyrrolidin-1-ium-1-yl]hexyl]pyrrolidin-1-ium-1-yl]pyrrolidin-1-yl]aniline dichloride.
| Compound Name | 4-[3-[1-[6-[1-[1-(4-aminophenyl)pyrrolidin-3-yl]pyrrolidin-1-ium-1-yl]hexyl]pyrrolidin-1-ium-1-yl]pyrrolidin-1-yl]aniline dichloride |
|---|---|
| PubChem CID | 160698764 |
| Molecular Formula | C34H54Cl2N6 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | 4-[3-[1-[6-[1-[1-(4-aminophenyl)pyrrolidin-3-yl]pyrrolidin-1-ium-1-yl]hexyl]pyrrolidin-1-ium-1-yl]pyrrolidin-1-yl]aniline dichloride |
| SMILES | Nc1ccc(N2CCC([N+]3(CCCCCC[N+]4(C5CCN(c6ccc(N)cc6)C5)CCCC4)CCCC3)C2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C34H54N6.2ClH/c35-29-9-13-31(14-10-29)37-19-17-33(27-37)39(23-5-6-24-39)21-3-1-2-4-22-40(25-7-8-26-40)34-18-20-38(28-34)32-15-11-30(36)12-16-32;;/h9-16,33-34H,1-8,17-28,35-36H2;2*1H/q+2;;/p-2 |
| InChIKey | XSYWKEKROIYOMP-UHFFFAOYSA-L |
| XLogP | -0.50 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|