C20H29ClFNO10 — CID 160699576
methyl (2R,4S,5S)-2,4-diacetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-5-[(2-chloroacetyl)amino]-3-fluorooxane-2-carboxylate (PubChem CID 160699576) has the molecular formula C20H29ClFNO10 and a molecular weight of 497.90 g/mol. Its IUPAC name is methyl (2R,4S,5S)-2,4-diacetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-5-[(2-chloroacetyl)amino]-3-fluorooxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5S)-2,4-diacetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-5-[(2-chloroacetyl)amino]-3-fluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 160699576 |
| Molecular Formula | C20H29ClFNO10 |
| Molecular Weight | 497.90 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | methyl (2R,4S,5S)-2,4-diacetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-5-[(2-chloroacetyl)amino]-3-fluorooxane-2-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](C)C1O[C@@](OC(C)=O)(C(=O)OC)C(F)[C@@H](OC(C)=O)[C@H]1NC(=O)CCl |
| InChI | InChI=1S/C20H29ClFNO10/c1-7-13(30-10(3)24)9(2)16-15(23-14(27)8-21)17(31-11(4)25)18(22)20(33-16,19(28)29-6)32-12(5)26/h9,13,15-18H,7-8H2,1-6H3,(H,23,27)/t9-,13-,15+,16?,17+,18?,20-/m1/s1 |
| InChIKey | RQLDOHLYIUTSPH-XBDIAMEASA-N |
| XLogP | 0.79 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.90 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|