C19H27ClN4O10S — CID 45104827
methyl (2S,4S,5R,6R)-4-acetyloxy-5-[(2-chloroacetyl)amino]-6-[(1R,2R)-1,2-diacetyloxy-3-azidopropyl]-2-methylsulfanyloxane-2-carboxylate (PubChem CID 45104827) has the molecular formula C19H27ClN4O10S and a molecular weight of 538.96 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-4-acetyloxy-5-[(2-chloroacetyl)amino]-6-[(1R,2R)-1,2-diacetyloxy-3-azidopropyl]-2-methylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-4-acetyloxy-5-[(2-chloroacetyl)amino]-6-[(1R,2R)-1,2-diacetyloxy-3-azidopropyl]-2-methylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 45104827 |
| Molecular Formula | C19H27ClN4O10S |
| Molecular Weight | 538.96 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | methyl (2S,4S,5R,6R)-4-acetyloxy-5-[(2-chloroacetyl)amino]-6-[(1R,2R)-1,2-diacetyloxy-3-azidopropyl]-2-methylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(SC)C[C@H](OC(C)=O)[C@@H](NC(=O)CCl)[C@H]([C@H](OC(C)=O)[C@@H](CN=[N+]=[N-])OC(C)=O)O1 |
| InChI | InChI=1S/C19H27ClN4O10S/c1-9(25)31-12-6-19(35-5,18(29)30-4)34-17(15(12)23-14(28)7-20)16(33-11(3)27)13(8-22-24-21)32-10(2)26/h12-13,15-17H,6-8H2,1-5H3,(H,23,28)/t12-,13+,15+,16+,17+,19-/m0/s1 |
| InChIKey | HMAARYUXEBVPEK-OXSFYUKISA-N |
| XLogP | 0.84 |
| TPSA | 192.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.96 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|