C19H33NO7S — CID 162238810
methyl (2R,4S,5S)-4-acetyloxy-6-(3-acetyloxypentan-2-yl)-3-amino-2-ethylsulfanyl-5-methyloxane-2-carboxylate (PubChem CID 162238810) has the molecular formula C19H33NO7S and a molecular weight of 419.54 g/mol. Its IUPAC name is methyl (2R,4S,5S)-4-acetyloxy-6-(3-acetyloxypentan-2-yl)-3-amino-2-ethylsulfanyl-5-methyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5S)-4-acetyloxy-6-(3-acetyloxypentan-2-yl)-3-amino-2-ethylsulfanyl-5-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 162238810 |
| Molecular Formula | C19H33NO7S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | methyl (2R,4S,5S)-4-acetyloxy-6-(3-acetyloxypentan-2-yl)-3-amino-2-ethylsulfanyl-5-methyloxane-2-carboxylate |
| SMILES | CCS[C@]1(C(=O)OC)OC(C(C)C(CC)OC(C)=O)[C@H](C)[C@H](OC(C)=O)C1N |
| InChI | InChI=1S/C19H33NO7S/c1-8-14(25-12(5)21)10(3)15-11(4)16(26-13(6)22)17(20)19(27-15,28-9-2)18(23)24-7/h10-11,14-17H,8-9,20H2,1-7H3/t10?,11-,14?,15?,16-,17?,19+/m0/s1 |
| InChIKey | CMSFYXDOAJHGRC-CFPXOJKZSA-N |
| XLogP | 1.88 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|