C26H28F2O3 — CID 160701496
2-acetyl-2-ethyl-5-fluoro-3H-inden-1-one;1-(2-ethyl-5-fluoro-1,3-dihydroinden-2-yl)ethanone (PubChem CID 160701496) has the molecular formula C26H28F2O3 and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-acetyl-2-ethyl-5-fluoro-3H-inden-1-one;1-(2-ethyl-5-fluoro-1,3-dihydroinden-2-yl)ethanone.
| Compound Name | 2-acetyl-2-ethyl-5-fluoro-3H-inden-1-one;1-(2-ethyl-5-fluoro-1,3-dihydroinden-2-yl)ethanone |
|---|---|
| PubChem CID | 160701496 |
| Molecular Formula | C26H28F2O3 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-acetyl-2-ethyl-5-fluoro-3H-inden-1-one;1-(2-ethyl-5-fluoro-1,3-dihydroinden-2-yl)ethanone |
| SMILES | CCC1(C(C)=O)Cc2cc(F)ccc2C1=O.CCC1(C(C)=O)Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C13H13FO2.C13H15FO/c1-3-13(8(2)15)7-9-6-10(14)4-5-11(9)12(13)16;1-3-13(9(2)15)7-10-4-5-12(14)6-11(10)8-13/h4-6H,3,7H2,1-2H3;4-6H,3,7-8H2,1-2H3 |
| InChIKey | RQRDLRGEXFGTCX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|