C52H46BrN5O8 — CID 160708996
tert-butyl 4-bromo-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate;tert-butyl 4-(2-nitrophenyl)-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate (PubChem CID 160708996) has the molecular formula C52H46BrN5O8 and a molecular weight of 948.87 g/mol. Its IUPAC name is tert-butyl 4-bromo-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate;tert-butyl 4-(2-nitrophenyl)-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate.
| Compound Name | tert-butyl 4-bromo-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate;tert-butyl 4-(2-nitrophenyl)-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 160708996 |
| Molecular Formula | C52H46BrN5O8 |
| Molecular Weight | 948.87 g/mol |
| Exact Mass | 947.25 |
| IUPAC Name | tert-butyl 4-bromo-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate;tert-butyl 4-(2-nitrophenyl)-2-[(5-phenylpyridine-3-carbonyl)amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2ccccc2[N+](=O)[O-])cc1NC(=O)c1cncc(-c2ccccc2)c1.CC(C)(C)OC(=O)c1ccc(Br)cc1NC(=O)c1cncc(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H25N3O5.C23H21BrN2O3/c1-29(2,3)37-28(34)24-14-13-20(23-11-7-8-12-26(23)32(35)36)16-25(24)31-27(33)22-15-21(17-30-18-22)19-9-5-4-6-10-19;1-23(2,3)29-22(28)19-10-9-18(24)12-20(19)26-21(27)17-11-16(13-25-14-17)15-7-5-4-6-8-15/h4-18H,1-3H3,(H,31,33);4-14H,1-3H3,(H,26,27) |
| InChIKey | RRPIXHFSULRUEV-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 179.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.87 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|