About 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane
2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane (PubChem CID 160720515) has the molecular formula C14H36NO3+
and a molecular weight of 266.45 g/mol. Its IUPAC name is 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane.
Molecular Properties
| Compound Name | 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane |
| PubChem CID | 160720515 |
| Molecular Formula | C14H36NO3+ |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane |
| SMILES | CCCOC.COC(C)C.COCC[N+](C)(C)C |
| InChI | InChI=1S/C6H16NO.2C4H10O/c1-7(2,3)5-6-8-4;1-4(2)5-3;1-3-4-5-2/h5-6H2,1-4H3;4H,1-3H3;3-4H2,1-2H3/q+1;; |
| InChIKey | RTASRSMDRPJELO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane?
The IUPAC name of 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane (CID 160720515) is 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane.
What is the SMILES notation for 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane?
The canonical SMILES for 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane is CCCOC.COC(C)C.COCC[N+](C)(C)C.
What is the InChIKey of 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane?
The InChIKey is RTASRSMDRPJELO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16NO.2C4H10O/c1-7(2,3)5-6-8-4;1-4(2)5-3;1-3-4-5-2/h5-6H2,1-4H3;4H,1-3H3;3-4H2,1-2H3/q+1;;.
What are the key properties of 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane?
2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane has a molecular weight of 266.45 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl(trimethyl)azanium;1-methoxypropane;2-methoxypropane is sourced from PubChem (CID 160720515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).