C24H20Cl2N2O10S2 — CID 160722237
4-chloro-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]benzenesulfonamide (PubChem CID 160722237) has the molecular formula C24H20Cl2N2O10S2 and a molecular weight of 631.47 g/mol. Its IUPAC name is 4-chloro-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 160722237 |
| Molecular Formula | C24H20Cl2N2O10S2 |
| Molecular Weight | 631.47 g/mol |
| Exact Mass | 629.99 |
| IUPAC Name | 4-chloro-N-[(5-hydroxy-4-oxopyran-2-yl)methyl]benzenesulfonamide |
| SMILES | O=c1cc(CNS(=O)(=O)c2ccc(Cl)cc2)occ1O.O=c1cc(CNS(=O)(=O)c2ccc(Cl)cc2)occ1O |
| InChI | InChI=1S/2C12H10ClNO5S/c2*13-8-1-3-10(4-2-8)20(17,18)14-6-9-5-11(15)12(16)7-19-9/h2*1-5,7,14,16H,6H2 |
| InChIKey | RTGDDNMIOFMYEL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 193.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |