C58H69ClF2N2O6 — CID 160727229
bis([3-[(2R,3R)-1-(dimethylamino)-3-hydroxy-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate);hydrochloride (PubChem CID 160727229) has the molecular formula C58H69ClF2N2O6 and a molecular weight of 963.65 g/mol. Its IUPAC name is bis([3-[(2R,3R)-1-(dimethylamino)-3-hydroxy-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate);hydrochloride.
| Compound Name | bis([3-[(2R,3R)-1-(dimethylamino)-3-hydroxy-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate);hydrochloride |
|---|---|
| PubChem CID | 160727229 |
| Molecular Formula | C58H69ClF2N2O6 |
| Molecular Weight | 963.65 g/mol |
| Exact Mass | 962.48 |
| IUPAC Name | bis([3-[(2R,3R)-1-(dimethylamino)-3-hydroxy-2-methylpentan-3-yl]phenyl] 2-(3-fluoro-4-phenylphenyl)propanoate);hydrochloride |
| SMILES | CC[C@](O)(c1cccc(OC(=O)C(C)c2ccc(-c3ccccc3)c(F)c2)c1)[C@H](C)CN(C)C.CC[C@](O)(c1cccc(OC(=O)C(C)c2ccc(-c3ccccc3)c(F)c2)c1)[C@H](C)CN(C)C.Cl |
| InChI | InChI=1S/2C29H34FNO3.ClH/c2*1-6-29(33,20(2)19-31(4)5)24-13-10-14-25(18-24)34-28(32)21(3)23-15-16-26(27(30)17-23)22-11-8-7-9-12-22;/h2*7-18,20-21,33H,6,19H2,1-5H3;1H/t2*20-,21?,29-;/m11./s1 |
| InChIKey | RDCIUFHGTKKWKI-KXBZGGSQSA-N |
| XLogP | 12.42 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.65 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|