About tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate
tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate (PubChem CID 160733744) has the molecular formula C23H28ClNO2S
and a molecular weight of 418.00 g/mol. Its IUPAC name is tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate.
Molecular Properties
| Compound Name | tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate |
| PubChem CID | 160733744 |
| Molecular Formula | C23H28ClNO2S |
| Molecular Weight | 418.00 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate |
| SMILES | CNCC(CC(=O)OC(C)(C)C)C1c2ccccc2SCc2c(Cl)cccc21 |
| InChI | InChI=1S/C23H28ClNO2S/c1-23(2,3)27-21(26)12-15(13-25-4)22-16-9-7-10-19(24)18(16)14-28-20-11-6-5-8-17(20)22/h5-11,15,22,25H,12-14H2,1-4H3 |
| InChIKey | RURIWVHXTZCJPI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.00 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate?
The IUPAC name of tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate (CID 160733744) is tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate.
What is the SMILES notation for tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate?
The canonical SMILES for tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate is CNCC(CC(=O)OC(C)(C)C)C1c2ccccc2SCc2c(Cl)cccc21.
What is the InChIKey of tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate?
The InChIKey is RURIWVHXTZCJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClNO2S/c1-23(2,3)27-21(26)12-15(13-25-4)22-16-9-7-10-19(24)18(16)14-28-20-11-6-5-8-17(20)22/h5-11,15,22,25H,12-14H2,1-4H3.
What are the key properties of tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate?
tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate has a molecular weight of 418.00 g/mol, XLogP of 5.64, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(7-chloro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(methylamino)butanoate is sourced from PubChem (CID 160733744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).