C25H40ClNO3S — CID 155179978
tert-butyl 3-[(5S)-5-[[(R)-tert-butylsulfinyl]amino]-1-chloro-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-8-yl]propanoate (PubChem CID 155179978) has the molecular formula C25H40ClNO3S and a molecular weight of 470.12 g/mol. Its IUPAC name is tert-butyl 3-[(5S)-5-[[(R)-tert-butylsulfinyl]amino]-1-chloro-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-8-yl]propanoate.
| Compound Name | tert-butyl 3-[(5S)-5-[[(R)-tert-butylsulfinyl]amino]-1-chloro-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-8-yl]propanoate |
|---|---|
| PubChem CID | 155179978 |
| Molecular Formula | C25H40ClNO3S |
| Molecular Weight | 470.12 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | tert-butyl 3-[(5S)-5-[[(R)-tert-butylsulfinyl]amino]-1-chloro-5,6,7,8,9,10,11,12-octahydrobenzo[10]annulen-8-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCC1CCCCc2c(Cl)cccc2[C@@H](N[S@](=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H40ClNO3S/c1-24(2,3)30-23(28)17-15-18-10-7-8-11-19-20(12-9-13-21(19)26)22(16-14-18)27-31(29)25(4,5)6/h9,12-13,18,22,27H,7-8,10-11,14-17H2,1-6H3/t18?,22-,31+/m0/s1 |
| InChIKey | YZUUZPXBRVTLBM-WNZSNSSPSA-N |
| XLogP | 6.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.12 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |