C30H43O3Si — CID 178115933
CID 178115933 (PubChem CID 178115933) has the molecular formula C30H43O3Si and a molecular weight of 479.76 g/mol.
| Compound Name | CID 178115933 |
|---|---|
| PubChem CID | 178115933 |
| Molecular Formula | C30H43O3Si |
| Molecular Weight | 479.76 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)CCC1CCC(CO[Si](c2ccccc2)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C30H43O3Si/c1-29(2,3)25-17-19-27(20-18-25)34(26-10-8-7-9-11-26)32-22-24-14-12-23(13-15-24)16-21-28(31)33-30(4,5)6/h7-11,17-20,23-24H,12-16,21-22H2,1-6H3 |
| InChIKey | GPQACJDUEHTPOO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|