C31H32O4Si3 — CID 160738916
2,2,4,4,16,16-hexamethyl-3,9,17,25-tetraoxa-2,4,16-trisilaheptacyclo[21.5.2.25,8.07,11.010,15.019,24.026,30]dotriaconta-1(29),5,7,10,12,14,19(24),20,22,26(30),27,31-dodecaene (PubChem CID 160738916) has the molecular formula C31H32O4Si3 and a molecular weight of 552.85 g/mol. Its IUPAC name is 2,2,4,4,16,16-hexamethyl-3,9,17,25-tetraoxa-2,4,16-trisilaheptacyclo[21.5.2.25,8.07,11.010,15.019,24.026,30]dotriaconta-1(29),5,7,10,12,14,19(24),20,22,26(30),27,31-dodecaene.
| Compound Name | 2,2,4,4,16,16-hexamethyl-3,9,17,25-tetraoxa-2,4,16-trisilaheptacyclo[21.5.2.25,8.07,11.010,15.019,24.026,30]dotriaconta-1(29),5,7,10,12,14,19(24),20,22,26(30),27,31-dodecaene |
|---|---|
| PubChem CID | 160738916 |
| Molecular Formula | C31H32O4Si3 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 2,2,4,4,16,16-hexamethyl-3,9,17,25-tetraoxa-2,4,16-trisilaheptacyclo[21.5.2.25,8.07,11.010,15.019,24.026,30]dotriaconta-1(29),5,7,10,12,14,19(24),20,22,26(30),27,31-dodecaene |
| SMILES | C[Si]1(C)O[Si](C)(C)c2ccc3oc4c(cccc4c3c2)[Si](C)(C)OCc2cccc3c2oc2ccc1cc23 |
| InChI | InChI=1S/C31H32O4Si3/c1-36(2)21-13-15-27-25(17-21)23-10-7-9-20(30(23)33-27)19-32-38(5,6)29-12-8-11-24-26-18-22(37(3,4)35-36)14-16-28(26)34-31(24)29/h7-18H,19H2,1-6H3 |
| InChIKey | PFBYTNXIYCOLSY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 44.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|